C18H20N4O3 — CID 41433363
(2R)-2-[[2-(benzylcarbamoylamino)acetyl]amino]-2-phenylacetamide (PubChem CID 41433363) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is (2R)-2-[[2-(benzylcarbamoylamino)acetyl]amino]-2-phenylacetamide.
| Compound Name | (2R)-2-[[2-(benzylcarbamoylamino)acetyl]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 41433363 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (2R)-2-[[2-(benzylcarbamoylamino)acetyl]amino]-2-phenylacetamide |
| SMILES | NC(=O)[C@H](NC(=O)CNC(=O)NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H20N4O3/c19-17(24)16(14-9-5-2-6-10-14)22-15(23)12-21-18(25)20-11-13-7-3-1-4-8-13/h1-10,16H,11-12H2,(H2,19,24)(H,22,23)(H2,20,21,25)/t16-/m1/s1 |
| InChIKey | YNGKSIMLNMWUCJ-MRXNPFEDSA-N |
| XLogP | 0.83 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |