C23H24ClN3O2 — CID 143631835
2-(benzylcarbamoylamino)-N-[(2E)-1-(4-chlorophenyl)-2-ethenylpenta-2,4-dienyl]acetamide (PubChem CID 143631835) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is 2-(benzylcarbamoylamino)-N-[(2E)-1-(4-chlorophenyl)-2-ethenylpenta-2,4-dienyl]acetamide.
| Compound Name | 2-(benzylcarbamoylamino)-N-[(2E)-1-(4-chlorophenyl)-2-ethenylpenta-2,4-dienyl]acetamide |
|---|---|
| PubChem CID | 143631835 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-(benzylcarbamoylamino)-N-[(2E)-1-(4-chlorophenyl)-2-ethenylpenta-2,4-dienyl]acetamide |
| SMILES | C=C/C=C(\C=C)C(NC(=O)CNC(=O)NCc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H24ClN3O2/c1-3-8-18(4-2)22(19-11-13-20(24)14-12-19)27-21(28)16-26-23(29)25-15-17-9-6-5-7-10-17/h3-14,22H,1-2,15-16H2,(H,27,28)(H2,25,26,29)/b18-8+ |
| InChIKey | CFFSTTCMIAPWGY-QGMBQPNBSA-N |
| XLogP | 4.30 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|