C13H13ClINS — CID 144935216
[[(2E)-1-(4-chlorophenyl)-2-ethenylpenta-2,4-dienyl]amino] thiohypoiodite (PubChem CID 144935216) has the molecular formula C13H13ClINS and a molecular weight of 377.68 g/mol. Its IUPAC name is [[(2E)-1-(4-chlorophenyl)-2-ethenylpenta-2,4-dienyl]amino] thiohypoiodite.
| Compound Name | [[(2E)-1-(4-chlorophenyl)-2-ethenylpenta-2,4-dienyl]amino] thiohypoiodite |
|---|---|
| PubChem CID | 144935216 |
| Molecular Formula | C13H13ClINS |
| Molecular Weight | 377.68 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | [[(2E)-1-(4-chlorophenyl)-2-ethenylpenta-2,4-dienyl]amino] thiohypoiodite |
| SMILES | C=C/C=C(\C=C)C(NSI)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H13ClINS/c1-3-5-10(4-2)13(16-17-15)11-6-8-12(14)9-7-11/h3-9,13,16H,1-2H2/b10-5+ |
| InChIKey | SBKWBMGEQVMETM-BJMVGYQFSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.68 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|