C16H21Cl2FN2 — CID 143909725
(3E,5E)-6-chloro-1-(4-chlorophenyl)-3-ethenylhepta-3,5-diene-1,2-diamine;fluoromethane (PubChem CID 143909725) has the molecular formula C16H21Cl2FN2 and a molecular weight of 331.26 g/mol. Its IUPAC name is (3E,5E)-6-chloro-1-(4-chlorophenyl)-3-ethenylhepta-3,5-diene-1,2-diamine;fluoromethane.
| Compound Name | (3E,5E)-6-chloro-1-(4-chlorophenyl)-3-ethenylhepta-3,5-diene-1,2-diamine;fluoromethane |
|---|---|
| PubChem CID | 143909725 |
| Molecular Formula | C16H21Cl2FN2 |
| Molecular Weight | 331.26 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | (3E,5E)-6-chloro-1-(4-chlorophenyl)-3-ethenylhepta-3,5-diene-1,2-diamine;fluoromethane |
| SMILES | C=C/C(=C\C=C(/C)Cl)C(N)C(N)c1ccc(Cl)cc1.CF |
| InChI | InChI=1S/C15H18Cl2N2.CH3F/c1-3-11(5-4-10(2)16)14(18)15(19)12-6-8-13(17)9-7-12;1-2/h3-9,14-15H,1,18-19H2,2H3;1H3/b10-4+,11-5+; |
| InChIKey | OZCJOHBNZCOQKP-DVHWKNMOSA-N |
| XLogP | 4.51 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.26 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|