C22H23F2N3O5 — CID 41443703
1-[2-[[4-(difluoromethoxy)benzoyl]amino]acetyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 41443703) has the molecular formula C22H23F2N3O5 and a molecular weight of 447.44 g/mol. Its IUPAC name is 1-[2-[[4-(difluoromethoxy)benzoyl]amino]acetyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-[[4-(difluoromethoxy)benzoyl]amino]acetyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 41443703 |
| Molecular Formula | C22H23F2N3O5 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 1-[2-[[4-(difluoromethoxy)benzoyl]amino]acetyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | O=C(NCC(=O)N1CCC(C(=O)Nc2ccccc2O)CC1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C22H23F2N3O5/c23-22(24)32-16-7-5-14(6-8-16)20(30)25-13-19(29)27-11-9-15(10-12-27)21(31)26-17-3-1-2-4-18(17)28/h1-8,15,22,28H,9-13H2,(H,25,30)(H,26,31) |
| InChIKey | DVJRWYVJUUQWMD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|