C23H26ClN5O2S — CID 41455840
(2S)-N-(4-chlorophenyl)-3-oxo-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]piperazine-1-carbothioamide (PubChem CID 41455840) has the molecular formula C23H26ClN5O2S and a molecular weight of 472.01 g/mol. Its IUPAC name is (2S)-N-(4-chlorophenyl)-3-oxo-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]piperazine-1-carbothioamide.
| Compound Name | (2S)-N-(4-chlorophenyl)-3-oxo-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 41455840 |
| Molecular Formula | C23H26ClN5O2S |
| Molecular Weight | 472.01 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | (2S)-N-(4-chlorophenyl)-3-oxo-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]piperazine-1-carbothioamide |
| SMILES | O=C1NCCN(C(=S)Nc2ccc(Cl)cc2)[C@H]1CC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H26ClN5O2S/c24-17-6-8-18(9-7-17)26-23(32)29-11-10-25-22(31)20(29)16-21(30)28-14-12-27(13-15-28)19-4-2-1-3-5-19/h1-9,20H,10-16H2,(H,25,31)(H,26,32)/t20-/m0/s1 |
| InChIKey | YPYDBGLHJZXWAV-FQEVSTJZSA-N |
| XLogP | 2.58 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.01 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|