C23H25Cl2N5O2S — CID 41455852
(2S)-N-(3,5-dichlorophenyl)-3-oxo-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]piperazine-1-carbothioamide (PubChem CID 41455852) has the molecular formula C23H25Cl2N5O2S and a molecular weight of 506.46 g/mol. Its IUPAC name is (2S)-N-(3,5-dichlorophenyl)-3-oxo-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]piperazine-1-carbothioamide.
| Compound Name | (2S)-N-(3,5-dichlorophenyl)-3-oxo-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 41455852 |
| Molecular Formula | C23H25Cl2N5O2S |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | (2S)-N-(3,5-dichlorophenyl)-3-oxo-2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]piperazine-1-carbothioamide |
| SMILES | O=C1NCCN(C(=S)Nc2cc(Cl)cc(Cl)c2)[C@H]1CC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H25Cl2N5O2S/c24-16-12-17(25)14-18(13-16)27-23(33)30-7-6-26-22(32)20(30)15-21(31)29-10-8-28(9-11-29)19-4-2-1-3-5-19/h1-5,12-14,20H,6-11,15H2,(H,26,32)(H,27,33)/t20-/m0/s1 |
| InChIKey | OLESVZAJTNBXQW-FQEVSTJZSA-N |
| XLogP | 3.23 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|