C23H24Cl2N4O3 — CID 17121263
4-(2,4-dichlorobenzoyl)-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]piperazin-2-one (PubChem CID 17121263) has the molecular formula C23H24Cl2N4O3 and a molecular weight of 475.38 g/mol. Its IUPAC name is 4-(2,4-dichlorobenzoyl)-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]piperazin-2-one.
| Compound Name | 4-(2,4-dichlorobenzoyl)-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 17121263 |
| Molecular Formula | C23H24Cl2N4O3 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 4-(2,4-dichlorobenzoyl)-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]piperazin-2-one |
| SMILES | O=C1NCCN(C(=O)c2ccc(Cl)cc2Cl)C1CC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H24Cl2N4O3/c24-16-6-7-18(19(25)14-16)23(32)29-9-8-26-22(31)20(29)15-21(30)28-12-10-27(11-13-28)17-4-2-1-3-5-17/h1-7,14,20H,8-13,15H2,(H,26,31) |
| InChIKey | FIJIKXHHHQDVDM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |