C27H32N4O5 — CID 17079347
4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]piperazin-2-one (PubChem CID 17079347) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is 4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]piperazin-2-one.
| Compound Name | 4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 17079347 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | 4-[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]piperazin-2-one |
| SMILES | COc1ccc(/C=C/C(=O)N2CCNC(=O)C2CC(=O)N2CCN(c3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C27H32N4O5/c1-35-23-10-8-20(18-24(23)36-2)9-11-25(32)31-13-12-28-27(34)22(31)19-26(33)30-16-14-29(15-17-30)21-6-4-3-5-7-21/h3-11,18,22H,12-17,19H2,1-2H3,(H,28,34)/b11-9+ |
| InChIKey | PRAOCRCIFZALBK-PKNBQFBNSA-N |
| XLogP | 1.78 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|