C12H10F3NO2 — CID 4145747
3-(2-phenylethenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-5-ol (PubChem CID 4145747) has the molecular formula C12H10F3NO2 and a molecular weight of 257.21 g/mol. Its IUPAC name is 3-(2-phenylethenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-5-ol.
| Compound Name | 3-(2-phenylethenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 4145747 |
| Molecular Formula | C12H10F3NO2 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3-(2-phenylethenyl)-5-(trifluoromethyl)-2H-1,2-oxazol-5-ol |
| SMILES | OC1(C(F)(F)F)C=C(C=Cc2ccccc2)NO1 |
| InChI | InChI=1S/C12H10F3NO2/c13-12(14,15)11(17)8-10(16-18-11)7-6-9-4-2-1-3-5-9/h1-8,16-17H |
| InChIKey | VFFYZTFVQPVNBA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |