C23H29N7O4 — CID 41475528
7-[(2S)-3-(3-ethylphenoxy)-2-hydroxypropyl]-8-(3-imidazol-1-ylpropylamino)-3-methylpurine-2,6-dione (PubChem CID 41475528) has the molecular formula C23H29N7O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is 7-[(2S)-3-(3-ethylphenoxy)-2-hydroxypropyl]-8-(3-imidazol-1-ylpropylamino)-3-methylpurine-2,6-dione.
| Compound Name | 7-[(2S)-3-(3-ethylphenoxy)-2-hydroxypropyl]-8-(3-imidazol-1-ylpropylamino)-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 41475528 |
| Molecular Formula | C23H29N7O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | 7-[(2S)-3-(3-ethylphenoxy)-2-hydroxypropyl]-8-(3-imidazol-1-ylpropylamino)-3-methylpurine-2,6-dione |
| SMILES | CCc1cccc(OC[C@@H](O)Cn2c(NCCCn3ccnc3)nc3c2c(=O)[nH]c(=O)n3C)c1 |
| InChI | InChI=1S/C23H29N7O4/c1-3-16-6-4-7-18(12-16)34-14-17(31)13-30-19-20(28(2)23(33)27-21(19)32)26-22(30)25-8-5-10-29-11-9-24-15-29/h4,6-7,9,11-12,15,17,31H,3,5,8,10,13-14H2,1-2H3,(H,25,26)(H,27,32,33)/t17-/m0/s1 |
| InChIKey | PEMYXQWPBIJJCY-KRWDZBQOSA-N |
| XLogP | 1.12 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|