C15H10ClN2O5S2- — CID 4151668
3-[5-[2-chloro-3-(4-nitrophenyl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate (PubChem CID 4151668) has the molecular formula C15H10ClN2O5S2- and a molecular weight of 397.84 g/mol. Its IUPAC name is 3-[5-[2-chloro-3-(4-nitrophenyl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | 3-[5-[2-chloro-3-(4-nitrophenyl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 4151668 |
| Molecular Formula | C15H10ClN2O5S2- |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 396.97 |
| IUPAC Name | 3-[5-[2-chloro-3-(4-nitrophenyl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
| SMILES | O=C([O-])CCN1C(=O)C(=CC(Cl)=Cc2ccc([N+](=O)[O-])cc2)SC1=S |
| InChI | InChI=1S/C15H11ClN2O5S2/c16-10(7-9-1-3-11(4-2-9)18(22)23)8-12-14(21)17(15(24)25-12)6-5-13(19)20/h1-4,7-8H,5-6H2,(H,19,20)/p-1 |
| InChIKey | OAFMWKMIUAMPHN-UHFFFAOYSA-M |
| XLogP | 2.06 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|