C16H11ClN2O7S2 — CID 98456585
(2R)-2-[(5E)-5-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid (PubChem CID 98456585) has the molecular formula C16H11ClN2O7S2 and a molecular weight of 442.86 g/mol. Its IUPAC name is (2R)-2-[(5E)-5-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid.
| Compound Name | (2R)-2-[(5E)-5-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid |
|---|---|
| PubChem CID | 98456585 |
| Molecular Formula | C16H11ClN2O7S2 |
| Molecular Weight | 442.86 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | (2R)-2-[(5E)-5-[(Z)-2-chloro-3-(4-nitrophenyl)prop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid |
| SMILES | O=C(O)C[C@H](C(=O)O)N1C(=O)/C(=C\C(Cl)=C\c2ccc([N+](=O)[O-])cc2)SC1=S |
| InChI | InChI=1S/C16H11ClN2O7S2/c17-9(5-8-1-3-10(4-2-8)19(25)26)6-12-14(22)18(16(27)28-12)11(15(23)24)7-13(20)21/h1-6,11H,7H2,(H,20,21)(H,23,24)/b9-5-,12-6+/t11-/m1/s1 |
| InChIKey | KPFAYZOKNVQHFR-MDZIGFAHSA-N |
| XLogP | 2.85 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.86 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|