C21H22N4O6S — CID 4158429
N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-2-quinazolin-4-yloxyacetamide (PubChem CID 4158429) has the molecular formula C21H22N4O6S and a molecular weight of 458.50 g/mol. Its IUPAC name is N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-2-quinazolin-4-yloxyacetamide.
| Compound Name | N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-2-quinazolin-4-yloxyacetamide |
|---|---|
| PubChem CID | 4158429 |
| Molecular Formula | C21H22N4O6S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-(4-methoxy-3-morpholin-4-ylsulfonylphenyl)-2-quinazolin-4-yloxyacetamide |
| SMILES | COc1ccc(NC(=O)COc2ncnc3ccccc23)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H22N4O6S/c1-29-18-7-6-15(12-19(18)32(27,28)25-8-10-30-11-9-25)24-20(26)13-31-21-16-4-2-3-5-17(16)22-14-23-21/h2-7,12,14H,8-11,13H2,1H3,(H,24,26) |
| InChIKey | RWBDIRWTUWBIHZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |