C25H24IN3O3 — CID 4160835
1-[4-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]phenyl]-3-(3-iodophenyl)urea (PubChem CID 4160835) has the molecular formula C25H24IN3O3 and a molecular weight of 541.39 g/mol. Its IUPAC name is 1-[4-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]phenyl]-3-(3-iodophenyl)urea.
| Compound Name | 1-[4-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]phenyl]-3-(3-iodophenyl)urea |
|---|---|
| PubChem CID | 4160835 |
| Molecular Formula | C25H24IN3O3 |
| Molecular Weight | 541.39 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | 1-[4-[(6,7-dimethoxy-3,4-dihydroisoquinolin-1-yl)methyl]phenyl]-3-(3-iodophenyl)urea |
| SMILES | COc1cc2c(cc1OC)C(Cc1ccc(NC(=O)Nc3cccc(I)c3)cc1)=NCC2 |
| InChI | InChI=1S/C25H24IN3O3/c1-31-23-13-17-10-11-27-22(21(17)15-24(23)32-2)12-16-6-8-19(9-7-16)28-25(30)29-20-5-3-4-18(26)14-20/h3-9,13-15H,10-12H2,1-2H3,(H2,28,29,30) |
| InChIKey | YYKPSMPVKAJVIE-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.39 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|