C15H21N3O4 — CID 4161575
3-[2-(2,4-dimethoxybenzoyl)hydrazinyl]-N-ethylbut-2-enamide (PubChem CID 4161575) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-[2-(2,4-dimethoxybenzoyl)hydrazinyl]-N-ethylbut-2-enamide.
| Compound Name | 3-[2-(2,4-dimethoxybenzoyl)hydrazinyl]-N-ethylbut-2-enamide |
|---|---|
| PubChem CID | 4161575 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 3-[2-(2,4-dimethoxybenzoyl)hydrazinyl]-N-ethylbut-2-enamide |
| SMILES | CCNC(=O)C=C(C)NNC(=O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C15H21N3O4/c1-5-16-14(19)8-10(2)17-18-15(20)12-7-6-11(21-3)9-13(12)22-4/h6-9,17H,5H2,1-4H3,(H,16,19)(H,18,20) |
| InChIKey | KKYATUKGOZMCQM-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|