C10H17NO2 — CID 4162
3,3-diethyl-5-methylpiperidine-2,4-dione (PubChem CID 4162) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 3,3-diethyl-5-methylpiperidine-2,4-dione.
| Compound Name | 3,3-diethyl-5-methylpiperidine-2,4-dione |
|---|---|
| PubChem CID | 4162 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 3,3-diethyl-5-methylpiperidine-2,4-dione |
| SMILES | CCC1(CC)C(=O)NCC(C)C1=O |
| InChI | InChI=1S/C10H17NO2/c1-4-10(5-2)8(12)7(3)6-11-9(10)13/h7H,4-6H2,1-3H3,(H,11,13) |
| InChIKey | SIDLZWOQUZRBRU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|