C16H15BrNO3S+ — CID 4165491
[3-(5-bromothiophene-2-carbonyl)-5-hydroxy-1-benzofuran-4-yl]methyl-dimethylazanium (PubChem CID 4165491) has the molecular formula C16H15BrNO3S+ and a molecular weight of 381.27 g/mol. Its IUPAC name is [3-(5-bromothiophene-2-carbonyl)-5-hydroxy-1-benzofuran-4-yl]methyl-dimethylazanium.
| Compound Name | [3-(5-bromothiophene-2-carbonyl)-5-hydroxy-1-benzofuran-4-yl]methyl-dimethylazanium |
|---|---|
| PubChem CID | 4165491 |
| Molecular Formula | C16H15BrNO3S+ |
| Molecular Weight | 381.27 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | [3-(5-bromothiophene-2-carbonyl)-5-hydroxy-1-benzofuran-4-yl]methyl-dimethylazanium |
| SMILES | C[NH+](C)Cc1c(O)ccc2occ(C(=O)c3ccc(Br)s3)c12 |
| InChI | InChI=1S/C16H14BrNO3S/c1-18(2)7-9-11(19)3-4-12-15(9)10(8-21-12)16(20)13-5-6-14(17)22-13/h3-6,8,19H,7H2,1-2H3/p+1 |
| InChIKey | RSPRTCUDVKIVAM-UHFFFAOYSA-O |
| XLogP | 2.84 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|