C27H21Cl2NO3 — CID 4167424
N-[3-chloro-4-(1-chloronaphthalen-2-yl)oxyphenyl]-5-oxo-5-phenylpentanamide (PubChem CID 4167424) has the molecular formula C27H21Cl2NO3 and a molecular weight of 478.38 g/mol. Its IUPAC name is N-[3-chloro-4-(1-chloronaphthalen-2-yl)oxyphenyl]-5-oxo-5-phenylpentanamide.
| Compound Name | N-[3-chloro-4-(1-chloronaphthalen-2-yl)oxyphenyl]-5-oxo-5-phenylpentanamide |
|---|---|
| PubChem CID | 4167424 |
| Molecular Formula | C27H21Cl2NO3 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | N-[3-chloro-4-(1-chloronaphthalen-2-yl)oxyphenyl]-5-oxo-5-phenylpentanamide |
| SMILES | O=C(CCCC(=O)c1ccccc1)Nc1ccc(Oc2ccc3ccccc3c2Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H21Cl2NO3/c28-22-17-20(30-26(32)12-6-11-23(31)19-8-2-1-3-9-19)14-16-24(22)33-25-15-13-18-7-4-5-10-21(18)27(25)29/h1-5,7-10,13-17H,6,11-12H2,(H,30,32) |
| InChIKey | IKIBZCWQHODKHT-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |