C34H30N6O10S3 — CID 4167937
2-[[5-[2-[3-(4-ethoxyphenoxy)-5-nitroanilino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(4-ethoxyphenoxy)-5-nitrophenyl]acetamide (PubChem CID 4167937) has the molecular formula C34H30N6O10S3 and a molecular weight of 778.85 g/mol. Its IUPAC name is 2-[[5-[2-[3-(4-ethoxyphenoxy)-5-nitroanilino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(4-ethoxyphenoxy)-5-nitrophenyl]acetamide.
| Compound Name | 2-[[5-[2-[3-(4-ethoxyphenoxy)-5-nitroanilino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(4-ethoxyphenoxy)-5-nitrophenyl]acetamide |
|---|---|
| PubChem CID | 4167937 |
| Molecular Formula | C34H30N6O10S3 |
| Molecular Weight | 778.85 g/mol |
| Exact Mass | 778.12 |
| IUPAC Name | 2-[[5-[2-[3-(4-ethoxyphenoxy)-5-nitroanilino]-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[3-(4-ethoxyphenoxy)-5-nitrophenyl]acetamide |
| SMILES | CCOc1ccc(Oc2cc(NC(=O)CSc3nnc(SCC(=O)Nc4cc(Oc5ccc(OCC)cc5)cc([N+](=O)[O-])c4)s3)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C34H30N6O10S3/c1-3-47-25-5-9-27(10-6-25)49-29-15-21(13-23(17-29)39(43)44)35-31(41)19-51-33-37-38-34(53-33)52-20-32(42)36-22-14-24(40(45)46)18-30(16-22)50-28-11-7-26(8-12-28)48-4-2/h5-18H,3-4,19-20H2,1-2H3,(H,35,41)(H,36,42) |
| InChIKey | OBOOVMGJOPSQTK-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 207.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.85 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|