C16H11N5O5S2 — CID 4910480
3-nitro-5-[[2-[(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]benzoic acid (PubChem CID 4910480) has the molecular formula C16H11N5O5S2 and a molecular weight of 417.43 g/mol. Its IUPAC name is 3-nitro-5-[[2-[(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]benzoic acid.
| Compound Name | 3-nitro-5-[[2-[(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 4910480 |
| Molecular Formula | C16H11N5O5S2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 3-nitro-5-[[2-[(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)sulfanyl]acetyl]amino]benzoic acid |
| SMILES | O=C(CSc1nnc(-c2ccncc2)s1)Nc1cc(C(=O)O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H11N5O5S2/c22-13(18-11-5-10(15(23)24)6-12(7-11)21(25)26)8-27-16-20-19-14(28-16)9-1-3-17-4-2-9/h1-7H,8H2,(H,18,22)(H,23,24) |
| InChIKey | WYSOMFAMZKBPRO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 148.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|