C36H32Cl2N4O8 — CID 4168840
8-(2,4-dichloroanilino)-6-[2-(2-hydroxyethoxy)phenyl]-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide (PubChem CID 4168840) has the molecular formula C36H32Cl2N4O8 and a molecular weight of 719.58 g/mol. Its IUPAC name is 8-(2,4-dichloroanilino)-6-[2-(2-hydroxyethoxy)phenyl]-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide.
| Compound Name | 8-(2,4-dichloroanilino)-6-[2-(2-hydroxyethoxy)phenyl]-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 4168840 |
| Molecular Formula | C36H32Cl2N4O8 |
| Molecular Weight | 719.58 g/mol |
| Exact Mass | 718.16 |
| IUPAC Name | 8-(2,4-dichloroanilino)-6-[2-(2-hydroxyethoxy)phenyl]-6a-(4-methoxyphenyl)-1,3,7,9-tetraoxo-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxamide |
| SMILES | COc1ccc(C23C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)C2CC2C(=CCC4C(=O)N(C(N)=O)C(=O)C42)C3c2ccccc2OCCO)cc1 |
| InChI | InChI=1S/C36H32Cl2N4O8/c1-49-20-9-6-18(7-10-20)36-25(32(45)42(34(36)47)40-27-13-8-19(37)16-26(27)38)17-24-21(30(36)22-4-2-3-5-28(22)50-15-14-43)11-12-23-29(24)33(46)41(31(23)44)35(39)48/h2-11,13,16,23-25,29-30,40,43H,12,14-15,17H2,1H3,(H2,39,48) |
| InChIKey | UBZGMDCCIKKLNY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 168.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|