C35H31Cl2N3O8 — CID 4656541
8-(2,4-dichloroanilino)-2-hydroxy-6-[2-(2-hydroxyethoxy)phenyl]-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4656541) has the molecular formula C35H31Cl2N3O8 and a molecular weight of 692.55 g/mol. Its IUPAC name is 8-(2,4-dichloroanilino)-2-hydroxy-6-[2-(2-hydroxyethoxy)phenyl]-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(2,4-dichloroanilino)-2-hydroxy-6-[2-(2-hydroxyethoxy)phenyl]-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4656541 |
| Molecular Formula | C35H31Cl2N3O8 |
| Molecular Weight | 692.55 g/mol |
| Exact Mass | 691.15 |
| IUPAC Name | 8-(2,4-dichloroanilino)-2-hydroxy-6-[2-(2-hydroxyethoxy)phenyl]-6a-(4-methoxyphenyl)-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1ccc(C23C(=O)N(Nc4ccc(Cl)cc4Cl)C(=O)C2CC2C(=CCC4C(=O)N(O)C(=O)C42)C3c2ccccc2OCCO)cc1 |
| InChI | InChI=1S/C35H31Cl2N3O8/c1-47-20-9-6-18(7-10-20)35-25(32(43)39(34(35)45)38-27-13-8-19(36)16-26(27)37)17-24-21(11-12-23-29(24)33(44)40(46)31(23)42)30(35)22-4-2-3-5-28(22)48-15-14-41/h2-11,13,16,23-25,29-30,38,41,46H,12,14-15,17H2,1H3 |
| InChIKey | USBNPHIHOUANHJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|