C23H31FN2O2 — CID 4169580
4-cyclooctyl-1-cyclopentyl-3-(4-fluorophenyl)piperazine-2,5-dione (PubChem CID 4169580) has the molecular formula C23H31FN2O2 and a molecular weight of 386.51 g/mol. Its IUPAC name is 4-cyclooctyl-1-cyclopentyl-3-(4-fluorophenyl)piperazine-2,5-dione.
| Compound Name | 4-cyclooctyl-1-cyclopentyl-3-(4-fluorophenyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 4169580 |
| Molecular Formula | C23H31FN2O2 |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 4-cyclooctyl-1-cyclopentyl-3-(4-fluorophenyl)piperazine-2,5-dione |
| SMILES | O=C1C(c2ccc(F)cc2)N(C2CCCCCCC2)C(=O)CN1C1CCCC1 |
| InChI | InChI=1S/C23H31FN2O2/c24-18-14-12-17(13-15-18)22-23(28)25(19-8-6-7-9-19)16-21(27)26(22)20-10-4-2-1-3-5-11-20/h12-15,19-20,22H,1-11,16H2 |
| InChIKey | WCOBWNJZOCXJOH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |