C21H24N4O3 — CID 4173846
3-[2-[2-(4-ethylanilino)-2-oxoacetyl]hydrazinyl]-N-(3-methylphenyl)but-2-enamide (PubChem CID 4173846) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 3-[2-[2-(4-ethylanilino)-2-oxoacetyl]hydrazinyl]-N-(3-methylphenyl)but-2-enamide.
| Compound Name | 3-[2-[2-(4-ethylanilino)-2-oxoacetyl]hydrazinyl]-N-(3-methylphenyl)but-2-enamide |
|---|---|
| PubChem CID | 4173846 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 3-[2-[2-(4-ethylanilino)-2-oxoacetyl]hydrazinyl]-N-(3-methylphenyl)but-2-enamide |
| SMILES | CCc1ccc(NC(=O)C(=O)NNC(C)=CC(=O)Nc2cccc(C)c2)cc1 |
| InChI | InChI=1S/C21H24N4O3/c1-4-16-8-10-17(11-9-16)23-20(27)21(28)25-24-15(3)13-19(26)22-18-7-5-6-14(2)12-18/h5-13,24H,4H2,1-3H3,(H,22,26)(H,23,27)(H,25,28) |
| InChIKey | FPKWISNFSHNOFH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|