C6H10N4O — CID 4173891
2,5-dimethylpyrazole-3-carbohydrazide (PubChem CID 4173891) has the molecular formula C6H10N4O and a molecular weight of 154.17 g/mol. Its IUPAC name is 2,5-dimethylpyrazole-3-carbohydrazide.
| Compound Name | 2,5-dimethylpyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 4173891 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 2,5-dimethylpyrazole-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NN)n(C)n1 |
| InChI | InChI=1S/C6H10N4O/c1-4-3-5(6(11)8-7)10(2)9-4/h3H,7H2,1-2H3,(H,8,11) |
| InChIKey | JNCYYXYBTYXWKZ-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|