C22H29N3O3 — CID 4174640
ethyl 2-[2-(4-tert-butylphenoxy)ethylimino]-2-(2-phenylhydrazinyl)acetate (PubChem CID 4174640) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is ethyl 2-[2-(4-tert-butylphenoxy)ethylimino]-2-(2-phenylhydrazinyl)acetate.
| Compound Name | ethyl 2-[2-(4-tert-butylphenoxy)ethylimino]-2-(2-phenylhydrazinyl)acetate |
|---|---|
| PubChem CID | 4174640 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | ethyl 2-[2-(4-tert-butylphenoxy)ethylimino]-2-(2-phenylhydrazinyl)acetate |
| SMILES | CCOC(=O)/C(=N\CCOc1ccc(C(C)(C)C)cc1)NNc1ccccc1 |
| InChI | InChI=1S/C22H29N3O3/c1-5-27-21(26)20(25-24-18-9-7-6-8-10-18)23-15-16-28-19-13-11-17(12-14-19)22(2,3)4/h6-14,24H,5,15-16H2,1-4H3,(H,23,25) |
| InChIKey | WYGZAYGZQJZQJE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|