C21H25N5O2 — CID 43860115
2-[5-[(4-tert-butylphenoxy)methyl]-1H-1,2,4-triazol-3-yl]-N'-phenylacetohydrazide (PubChem CID 43860115) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-[5-[(4-tert-butylphenoxy)methyl]-1H-1,2,4-triazol-3-yl]-N'-phenylacetohydrazide.
| Compound Name | 2-[5-[(4-tert-butylphenoxy)methyl]-1H-1,2,4-triazol-3-yl]-N'-phenylacetohydrazide |
|---|---|
| PubChem CID | 43860115 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 2-[5-[(4-tert-butylphenoxy)methyl]-1H-1,2,4-triazol-3-yl]-N'-phenylacetohydrazide |
| SMILES | CC(C)(C)c1ccc(OCc2nc(CC(=O)NNc3ccccc3)n[nH]2)cc1 |
| InChI | InChI=1S/C21H25N5O2/c1-21(2,3)15-9-11-17(12-10-15)28-14-19-22-18(24-25-19)13-20(27)26-23-16-7-5-4-6-8-16/h4-12,23H,13-14H2,1-3H3,(H,26,27)(H,22,24,25) |
| InChIKey | YOXLXNSYVUIYBH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|