C26H24N4O6S2 — CID 4177672
4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-[3-(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 4177672) has the molecular formula C26H24N4O6S2 and a molecular weight of 552.63 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-[3-(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-[3-(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 4177672 |
| Molecular Formula | C26H24N4O6S2 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | 4-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-N-[3-(2-methoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | COCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N3CCc4ccccc4C3)cc2)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C26H24N4O6S2/c1-36-15-14-29-23-11-8-21(30(32)33)16-24(23)37-26(29)27-25(31)19-6-9-22(10-7-19)38(34,35)28-13-12-18-4-2-3-5-20(18)17-28/h2-11,16H,12-15,17H2,1H3/b27-26- |
| InChIKey | LJLWBVYLQPCLEO-RQZHXJHFSA-N |
| XLogP | 3.75 |
| TPSA | 124.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|