C10H14BrN3O2S — CID 4180144
1-[(5-bromofuran-2-carbonyl)amino]-3-(2-methylpropyl)thiourea (PubChem CID 4180144) has the molecular formula C10H14BrN3O2S and a molecular weight of 320.21 g/mol. Its IUPAC name is 1-[(5-bromofuran-2-carbonyl)amino]-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[(5-bromofuran-2-carbonyl)amino]-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 4180144 |
| Molecular Formula | C10H14BrN3O2S |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 319.00 |
| IUPAC Name | 1-[(5-bromofuran-2-carbonyl)amino]-3-(2-methylpropyl)thiourea |
| SMILES | CC(C)CNC(=S)NNC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C10H14BrN3O2S/c1-6(2)5-12-10(17)14-13-9(15)7-3-4-8(11)16-7/h3-4,6H,5H2,1-2H3,(H,13,15)(H2,12,14,17) |
| InChIKey | LGKBCYGCGQUVIZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|