C21H12Br2N6O3S — CID 4182785
2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]-N-(2,6-dibromo-4-nitrophenyl)acetamide (PubChem CID 4182785) has the molecular formula C21H12Br2N6O3S and a molecular weight of 588.24 g/mol. Its IUPAC name is 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]-N-(2,6-dibromo-4-nitrophenyl)acetamide.
| Compound Name | 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]-N-(2,6-dibromo-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 4182785 |
| Molecular Formula | C21H12Br2N6O3S |
| Molecular Weight | 588.24 g/mol |
| Exact Mass | 585.91 |
| IUPAC Name | 2-[(6-amino-3,5-dicyano-4-phenyl-2-pyridinyl)sulfanyl]-N-(2,6-dibromo-4-nitrophenyl)acetamide |
| SMILES | N#Cc1c(N)nc(SCC(=O)Nc2c(Br)cc([N+](=O)[O-])cc2Br)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C21H12Br2N6O3S/c22-15-6-12(29(31)32)7-16(23)19(15)27-17(30)10-33-21-14(9-25)18(11-4-2-1-3-5-11)13(8-24)20(26)28-21/h1-7H,10H2,(H2,26,28)(H,27,30) |
| InChIKey | CRFRNQYLVOPQPW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 158.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.24 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|