C18H25N4O3S+ — CID 4183310
2-(1,4-dioxa-8-azoniaspiro[4.5]decan-8-ylmethyl)-5-(4-methoxyphenyl)-4-methyl-1,2,4-triazole-3-thione (PubChem CID 4183310) has the molecular formula C18H25N4O3S+ and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-(1,4-dioxa-8-azoniaspiro[4.5]decan-8-ylmethyl)-5-(4-methoxyphenyl)-4-methyl-1,2,4-triazole-3-thione.
| Compound Name | 2-(1,4-dioxa-8-azoniaspiro[4.5]decan-8-ylmethyl)-5-(4-methoxyphenyl)-4-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 4183310 |
| Molecular Formula | C18H25N4O3S+ |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2-(1,4-dioxa-8-azoniaspiro[4.5]decan-8-ylmethyl)-5-(4-methoxyphenyl)-4-methyl-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(-c2nn(C[NH+]3CCC4(CC3)OCCO4)c(=S)n2C)cc1 |
| InChI | InChI=1S/C18H24N4O3S/c1-20-16(14-3-5-15(23-2)6-4-14)19-22(17(20)26)13-21-9-7-18(8-10-21)24-11-12-25-18/h3-6H,7-13H2,1-2H3/p+1 |
| InChIKey | LLLITWBJTAERML-UHFFFAOYSA-O |
| XLogP | 1.01 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|