About acetic acid;(2-bromo-4-mercurio-5-methoxycarbonylfuran-3-yl)mercury
acetic acid;(2-bromo-4-mercurio-5-methoxycarbonylfuran-3-yl)mercury (PubChem CID 4189460) has the molecular formula C10H11BrHg2O7
and a molecular weight of 724.27 g/mol. Its IUPAC name is acetic acid;(2-bromo-4-mercurio-5-methoxycarbonylfuran-3-yl)mercury.
Molecular Properties
| Compound Name | acetic acid;(2-bromo-4-mercurio-5-methoxycarbonylfuran-3-yl)mercury |
| PubChem CID | 4189460 |
| Molecular Formula | C10H11BrHg2O7 |
| Molecular Weight | 724.27 g/mol |
| Exact Mass | 725.91 |
| IUPAC Name | acetic acid;(2-bromo-4-mercurio-5-methoxycarbonylfuran-3-yl)mercury |
| SMILES | CC(=O)O.CC(=O)O.COC(=O)c1oc(Br)c([Hg])c1[Hg] |
| InChI | InChI=1S/C6H3BrO3.2C2H4O2.2Hg/c1-9-6(8)4-2-3-5(7)10-4;2*1-2(3)4;;/h1H3;2*1H3,(H,3,4);; |
| InChIKey | YMYUWHJFMWECAZ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 724.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;(2-bromo-4-mercurio-5-methoxycarbonylfuran-3-yl)mercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(2-bromo-4-mercurio-5-methoxycarbonylfuran-3-yl)mercury?
The IUPAC name of acetic acid;(2-bromo-4-mercurio-5-methoxycarbonylfuran-3-yl)mercury (CID 4189460) is acetic acid;(2-bromo-4-mercurio-5-methoxycarbonylfuran-3-yl)mercury.
What is the SMILES notation for acetic acid;(2-bromo-4-mercurio-5-methoxycarbonylfuran-3-yl)mercury?
The canonical SMILES for acetic acid;(2-bromo-4-mercurio-5-methoxycarbonylfuran-3-yl)mercury is CC(=O)O.CC(=O)O.COC(=O)c1oc(Br)c([Hg])c1[Hg].
What is the InChIKey of acetic acid;(2-bromo-4-mercurio-5-methoxycarbonylfuran-3-yl)mercury?
The InChIKey is YMYUWHJFMWECAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrO3.2C2H4O2.2Hg/c1-9-6(8)4-2-3-5(7)10-4;2*1-2(3)4;;/h1H3;2*1H3,(H,3,4);;.
What are the key properties of acetic acid;(2-bromo-4-mercurio-5-methoxycarbonylfuran-3-yl)mercury?
acetic acid;(2-bromo-4-mercurio-5-methoxycarbonylfuran-3-yl)mercury has a molecular weight of 724.27 g/mol, XLogP of 0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(2-bromo-4-mercurio-5-methoxycarbonylfuran-3-yl)mercury is sourced from PubChem (CID 4189460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).