C7H13N5S2 — CID 4192537
2-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine (PubChem CID 4192537) has the molecular formula C7H13N5S2 and a molecular weight of 231.35 g/mol. Its IUPAC name is 2-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 4192537 |
| Molecular Formula | C7H13N5S2 |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 2-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]guanidine |
| SMILES | NCCSCc1csc(N=C(N)N)n1 |
| InChI | InChI=1S/C7H13N5S2/c8-1-2-13-3-5-4-14-7(11-5)12-6(9)10/h4H,1-3,8H2,(H4,9,10,11,12) |
| InChIKey | JFINSZHXZPNADJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|