C15H14ClNOS — CID 4195179
1-[1-(4-chlorophenyl)-4,6-dimethyl-2-sulfanylidene-3-pyridinyl]ethanone (PubChem CID 4195179) has the molecular formula C15H14ClNOS and a molecular weight of 291.80 g/mol. Its IUPAC name is 1-[1-(4-chlorophenyl)-4,6-dimethyl-2-sulfanylidene-3-pyridinyl]ethanone.
| Compound Name | 1-[1-(4-chlorophenyl)-4,6-dimethyl-2-sulfanylidene-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 4195179 |
| Molecular Formula | C15H14ClNOS |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 1-[1-(4-chlorophenyl)-4,6-dimethyl-2-sulfanylidene-3-pyridinyl]ethanone |
| SMILES | CC(=O)c1c(C)cc(C)n(-c2ccc(Cl)cc2)c1=S |
| InChI | InChI=1S/C15H14ClNOS/c1-9-8-10(2)17(15(19)14(9)11(3)18)13-6-4-12(16)5-7-13/h4-8H,1-3H3 |
| InChIKey | YHHSKARQWCZBGN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|