C36H36N2O8 — CID 4200750
diethyl 1-(1-ethoxy-3-ethoxycarbonyl-1-oxo-4,4-diphenylbut-3-en-2-yl)-5-phenylpyrazole-3,4-dicarboxylate (PubChem CID 4200750) has the molecular formula C36H36N2O8 and a molecular weight of 624.69 g/mol. Its IUPAC name is diethyl 1-(1-ethoxy-3-ethoxycarbonyl-1-oxo-4,4-diphenylbut-3-en-2-yl)-5-phenylpyrazole-3,4-dicarboxylate.
| Compound Name | diethyl 1-(1-ethoxy-3-ethoxycarbonyl-1-oxo-4,4-diphenylbut-3-en-2-yl)-5-phenylpyrazole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 4200750 |
| Molecular Formula | C36H36N2O8 |
| Molecular Weight | 624.69 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | diethyl 1-(1-ethoxy-3-ethoxycarbonyl-1-oxo-4,4-diphenylbut-3-en-2-yl)-5-phenylpyrazole-3,4-dicarboxylate |
| SMILES | CCOC(=O)C(=C(c1ccccc1)c1ccccc1)C(C(=O)OCC)n1nc(C(=O)OCC)c(C(=O)OCC)c1-c1ccccc1 |
| InChI | InChI=1S/C36H36N2O8/c1-5-43-33(39)28(27(24-18-12-9-13-19-24)25-20-14-10-15-21-25)32(36(42)46-8-4)38-31(26-22-16-11-17-23-26)29(34(40)44-6-2)30(37-38)35(41)45-7-3/h9-23,32H,5-8H2,1-4H3 |
| InChIKey | GKWYGZYMKPGMFR-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 123.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.69 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|