C23H29N3O5S — CID 42015638
N-[1-(furan-2-carbonyl)piperidin-4-yl]-4-[(3R)-3-methylpiperidin-1-yl]sulfonylbenzamide (PubChem CID 42015638) has the molecular formula C23H29N3O5S and a molecular weight of 459.57 g/mol. Its IUPAC name is N-[1-(furan-2-carbonyl)piperidin-4-yl]-4-[(3R)-3-methylpiperidin-1-yl]sulfonylbenzamide.
| Compound Name | N-[1-(furan-2-carbonyl)piperidin-4-yl]-4-[(3R)-3-methylpiperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 42015638 |
| Molecular Formula | C23H29N3O5S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | N-[1-(furan-2-carbonyl)piperidin-4-yl]-4-[(3R)-3-methylpiperidin-1-yl]sulfonylbenzamide |
| SMILES | C[C@@H]1CCCN(S(=O)(=O)c2ccc(C(=O)NC3CCN(C(=O)c4ccco4)CC3)cc2)C1 |
| InChI | InChI=1S/C23H29N3O5S/c1-17-4-2-12-26(16-17)32(29,30)20-8-6-18(7-9-20)22(27)24-19-10-13-25(14-11-19)23(28)21-5-3-15-31-21/h3,5-9,15,17,19H,2,4,10-14,16H2,1H3,(H,24,27)/t17-/m1/s1 |
| InChIKey | QJWXDTFFWCPNKM-QGZVFWFLSA-N |
| XLogP | 2.73 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |