C15H16N4O4 — CID 4201618
N-[1-(4-hydroxyphenyl)ethylideneamino]-1,3-dimethyl-2,6-dioxopyrimidine-4-carboxamide (PubChem CID 4201618) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is N-[1-(4-hydroxyphenyl)ethylideneamino]-1,3-dimethyl-2,6-dioxopyrimidine-4-carboxamide.
| Compound Name | N-[1-(4-hydroxyphenyl)ethylideneamino]-1,3-dimethyl-2,6-dioxopyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 4201618 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[1-(4-hydroxyphenyl)ethylideneamino]-1,3-dimethyl-2,6-dioxopyrimidine-4-carboxamide |
| SMILES | CC(=NNC(=O)c1cc(=O)n(C)c(=O)n1C)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H16N4O4/c1-9(10-4-6-11(20)7-5-10)16-17-14(22)12-8-13(21)19(3)15(23)18(12)2/h4-8,20H,1-3H3,(H,17,22) |
| InChIKey | RZPAHONXZOVDOB-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|