C14H14N4O4 — CID 135684068
N-[(E)-(2-hydroxyphenyl)methylideneamino]-1,3-dimethyl-2,6-dioxopyrimidine-4-carboxamide (PubChem CID 135684068) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is N-[(E)-(2-hydroxyphenyl)methylideneamino]-1,3-dimethyl-2,6-dioxopyrimidine-4-carboxamide.
| Compound Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-1,3-dimethyl-2,6-dioxopyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 135684068 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | N-[(E)-(2-hydroxyphenyl)methylideneamino]-1,3-dimethyl-2,6-dioxopyrimidine-4-carboxamide |
| SMILES | Cn1c(C(=O)N/N=C/c2ccccc2O)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C14H14N4O4/c1-17-10(7-12(20)18(2)14(17)22)13(21)16-15-8-9-5-3-4-6-11(9)19/h3-8,19H,1-2H3,(H,16,21)/b15-8+ |
| InChIKey | NKSKXMUHAPKIDZ-OVCLIPMQSA-N |
| XLogP | -0.45 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|