C13H11FN4O3 — CID 44724108
N-[(E)-(2-fluorophenyl)methylideneamino]-3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 44724108) has the molecular formula C13H11FN4O3 and a molecular weight of 290.25 g/mol. Its IUPAC name is N-[(E)-(2-fluorophenyl)methylideneamino]-3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-[(E)-(2-fluorophenyl)methylideneamino]-3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 44724108 |
| Molecular Formula | C13H11FN4O3 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-[(E)-(2-fluorophenyl)methylideneamino]-3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | Cn1c(=O)cc(C(=O)N/N=C/c2ccccc2F)[nH]c1=O |
| InChI | InChI=1S/C13H11FN4O3/c1-18-11(19)6-10(16-13(18)21)12(20)17-15-7-8-4-2-3-5-9(8)14/h2-7H,1H3,(H,16,21)(H,17,20)/b15-7+ |
| InChIKey | BTBCEWGZNRYUHS-VIZOYTHASA-N |
| XLogP | -0.02 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|