C17H21N5O3 — CID 4991880
N-[[4-(diethylamino)phenyl]methylideneamino]-3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxamide (PubChem CID 4991880) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[[4-(diethylamino)phenyl]methylideneamino]-3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxamide.
| Compound Name | N-[[4-(diethylamino)phenyl]methylideneamino]-3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 4991880 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-[[4-(diethylamino)phenyl]methylideneamino]-3-methyl-2,4-dioxo-1H-pyrimidine-6-carboxamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)c2cc(=O)n(C)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C17H21N5O3/c1-4-22(5-2)13-8-6-12(7-9-13)11-18-20-16(24)14-10-15(23)21(3)17(25)19-14/h6-11H,4-5H2,1-3H3,(H,19,25)(H,20,24) |
| InChIKey | JJDCOZYTRHLHGN-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 99.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|