C20H27N3O6S2 — CID 42029597
4-[(4-methoxyphenyl)sulfonyl-methylamino]-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]butanamide (PubChem CID 42029597) has the molecular formula C20H27N3O6S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)sulfonyl-methylamino]-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]butanamide.
| Compound Name | 4-[(4-methoxyphenyl)sulfonyl-methylamino]-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 42029597 |
| Molecular Formula | C20H27N3O6S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 4-[(4-methoxyphenyl)sulfonyl-methylamino]-N-[(1R)-1-(4-sulfamoylphenyl)ethyl]butanamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CCCC(=O)N[C@H](C)c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C20H27N3O6S2/c1-15(16-6-10-18(11-7-16)30(21,25)26)22-20(24)5-4-14-23(2)31(27,28)19-12-8-17(29-3)9-13-19/h6-13,15H,4-5,14H2,1-3H3,(H,22,24)(H2,21,25,26)/t15-/m1/s1 |
| InChIKey | BFEOKEGTJKFQKA-OAHLLOKOSA-N |
| XLogP | 1.62 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |