C16H22O4 — CID 4206221
7-methoxy-5a,9-dimethyl-3,4,4a,5,9,9a,10,10a-octahydrobenzo[g]chromene-2,6-dione (PubChem CID 4206221) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 7-methoxy-5a,9-dimethyl-3,4,4a,5,9,9a,10,10a-octahydrobenzo[g]chromene-2,6-dione.
| Compound Name | 7-methoxy-5a,9-dimethyl-3,4,4a,5,9,9a,10,10a-octahydrobenzo[g]chromene-2,6-dione |
|---|---|
| PubChem CID | 4206221 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 7-methoxy-5a,9-dimethyl-3,4,4a,5,9,9a,10,10a-octahydrobenzo[g]chromene-2,6-dione |
| SMILES | COC1=CC(C)C2CC3OC(=O)CCC3CC2(C)C1=O |
| InChI | InChI=1S/C16H22O4/c1-9-6-13(19-3)15(18)16(2)8-10-4-5-14(17)20-12(10)7-11(9)16/h6,9-12H,4-5,7-8H2,1-3H3 |
| InChIKey | PANLNJBDLMNCCW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |