C18H20N6O3 — CID 4207312
N-(1,3-benzodioxol-5-yl)-5-(3,5-dimethylpiperidin-1-yl)-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine (PubChem CID 4207312) has the molecular formula C18H20N6O3 and a molecular weight of 368.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-(3,5-dimethylpiperidin-1-yl)-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-(3,5-dimethylpiperidin-1-yl)-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 4207312 |
| Molecular Formula | C18H20N6O3 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-(3,5-dimethylpiperidin-1-yl)-[1,2,5]oxadiazolo[3,4-b]pyrazin-6-amine |
| SMILES | CC1CC(C)CN(c2nc3nonc3nc2Nc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C18H20N6O3/c1-10-5-11(2)8-24(7-10)18-17(20-15-16(21-18)23-27-22-15)19-12-3-4-13-14(6-12)26-9-25-13/h3-4,6,10-11H,5,7-9H2,1-2H3,(H,19,20,22) |
| InChIKey | RMDYUGPGSMXTKF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 98.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |