C25H28N2O4S — CID 42088350
N-(4-benzamido-2,5-dimethoxyphenyl)-4-ethyl-5-propylthiophene-2-carboxamide (PubChem CID 42088350) has the molecular formula C25H28N2O4S and a molecular weight of 452.58 g/mol. Its IUPAC name is N-(4-benzamido-2,5-dimethoxyphenyl)-4-ethyl-5-propylthiophene-2-carboxamide.
| Compound Name | N-(4-benzamido-2,5-dimethoxyphenyl)-4-ethyl-5-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 42088350 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | N-(4-benzamido-2,5-dimethoxyphenyl)-4-ethyl-5-propylthiophene-2-carboxamide |
| SMILES | CCCc1sc(C(=O)Nc2cc(OC)c(NC(=O)c3ccccc3)cc2OC)cc1CC |
| InChI | InChI=1S/C25H28N2O4S/c1-5-10-22-16(6-2)13-23(32-22)25(29)27-19-15-20(30-3)18(14-21(19)31-4)26-24(28)17-11-8-7-9-12-17/h7-9,11-15H,5-6,10H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | CUQJIYOPHKADKA-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |