C19H26N4O3S — CID 42098185
4-[[3-(2-methylpropyl)-2-methylsulfonylimidazol-4-yl]methyl]-1-phenylpiperazin-2-one (PubChem CID 42098185) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 4-[[3-(2-methylpropyl)-2-methylsulfonylimidazol-4-yl]methyl]-1-phenylpiperazin-2-one.
| Compound Name | 4-[[3-(2-methylpropyl)-2-methylsulfonylimidazol-4-yl]methyl]-1-phenylpiperazin-2-one |
|---|---|
| PubChem CID | 42098185 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 4-[[3-(2-methylpropyl)-2-methylsulfonylimidazol-4-yl]methyl]-1-phenylpiperazin-2-one |
| SMILES | CC(C)Cn1c(CN2CCN(c3ccccc3)C(=O)C2)cnc1S(C)(=O)=O |
| InChI | InChI=1S/C19H26N4O3S/c1-15(2)12-23-17(11-20-19(23)27(3,25)26)13-21-9-10-22(18(24)14-21)16-7-5-4-6-8-16/h4-8,11,15H,9-10,12-14H2,1-3H3 |
| InChIKey | VUJWVGSDIUUNTE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |