C16H18N4O — CID 69235175
1-(6-amino-3-pyridinyl)-4-benzylpiperazin-2-one (PubChem CID 69235175) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 1-(6-amino-3-pyridinyl)-4-benzylpiperazin-2-one.
| Compound Name | 1-(6-amino-3-pyridinyl)-4-benzylpiperazin-2-one |
|---|---|
| PubChem CID | 69235175 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-(6-amino-3-pyridinyl)-4-benzylpiperazin-2-one |
| SMILES | Nc1ccc(N2CCN(Cc3ccccc3)CC2=O)cn1 |
| InChI | InChI=1S/C16H18N4O/c17-15-7-6-14(10-18-15)20-9-8-19(12-16(20)21)11-13-4-2-1-3-5-13/h1-7,10H,8-9,11-12H2,(H2,17,18) |
| InChIKey | OWIPDMRGDFMMJA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |