C18H22FN5O2 — CID 42099259
[4-(2-fluorophenyl)piperazin-1-yl]-[1-[[(2R)-oxolan-2-yl]methyl]triazol-4-yl]methanone (PubChem CID 42099259) has the molecular formula C18H22FN5O2 and a molecular weight of 359.41 g/mol. Its IUPAC name is [4-(2-fluorophenyl)piperazin-1-yl]-[1-[[(2R)-oxolan-2-yl]methyl]triazol-4-yl]methanone.
| Compound Name | [4-(2-fluorophenyl)piperazin-1-yl]-[1-[[(2R)-oxolan-2-yl]methyl]triazol-4-yl]methanone |
|---|---|
| PubChem CID | 42099259 |
| Molecular Formula | C18H22FN5O2 |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | [4-(2-fluorophenyl)piperazin-1-yl]-[1-[[(2R)-oxolan-2-yl]methyl]triazol-4-yl]methanone |
| SMILES | O=C(c1cn(C[C@H]2CCCO2)nn1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H22FN5O2/c19-15-5-1-2-6-17(15)22-7-9-23(10-8-22)18(25)16-13-24(21-20-16)12-14-4-3-11-26-14/h1-2,5-6,13-14H,3-4,7-12H2/t14-/m1/s1 |
| InChIKey | HKGDBUXOPAETMR-CQSZACIVSA-N |
| XLogP | 1.56 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |