C19H22N6O2 — CID 45236383
N-[[1-(2-methylphenyl)pyrazol-4-yl]methyl]-1-(oxolan-2-ylmethyl)triazole-4-carboxamide (PubChem CID 45236383) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is N-[[1-(2-methylphenyl)pyrazol-4-yl]methyl]-1-(oxolan-2-ylmethyl)triazole-4-carboxamide.
| Compound Name | N-[[1-(2-methylphenyl)pyrazol-4-yl]methyl]-1-(oxolan-2-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 45236383 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | N-[[1-(2-methylphenyl)pyrazol-4-yl]methyl]-1-(oxolan-2-ylmethyl)triazole-4-carboxamide |
| SMILES | Cc1ccccc1-n1cc(CNC(=O)c2cn(CC3CCCO3)nn2)cn1 |
| InChI | InChI=1S/C19H22N6O2/c1-14-5-2-3-7-18(14)25-11-15(10-21-25)9-20-19(26)17-13-24(23-22-17)12-16-6-4-8-27-16/h2-3,5,7,10-11,13,16H,4,6,8-9,12H2,1H3,(H,20,26) |
| InChIKey | UHOHVHVWGGVHCQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |