C17H22N4O4 — CID 56902904
N-[2-(3-hydroxy-4-methoxyphenyl)ethyl]-1-(oxolan-2-ylmethyl)triazole-4-carboxamide (PubChem CID 56902904) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-[2-(3-hydroxy-4-methoxyphenyl)ethyl]-1-(oxolan-2-ylmethyl)triazole-4-carboxamide.
| Compound Name | N-[2-(3-hydroxy-4-methoxyphenyl)ethyl]-1-(oxolan-2-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 56902904 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-[2-(3-hydroxy-4-methoxyphenyl)ethyl]-1-(oxolan-2-ylmethyl)triazole-4-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2cn(CC3CCCO3)nn2)cc1O |
| InChI | InChI=1S/C17H22N4O4/c1-24-16-5-4-12(9-15(16)22)6-7-18-17(23)14-11-21(20-19-14)10-13-3-2-8-25-13/h4-5,9,11,13,22H,2-3,6-8,10H2,1H3,(H,18,23) |
| InChIKey | HFFVRAPHRQTPLX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |